C20H21NO10 — CID 44550407
[(1S,5R,6S)-5,6-diacetyloxy-3-ethoxycarbonylcyclohex-3-en-1-yl] 4-nitrobenzoate (PubChem CID 44550407) has the molecular formula C20H21NO10 and a molecular weight of 435.39 g/mol. Its IUPAC name is [(1S,5R,6S)-5,6-diacetyloxy-3-ethoxycarbonylcyclohex-3-en-1-yl] 4-nitrobenzoate.
| Compound Name | [(1S,5R,6S)-5,6-diacetyloxy-3-ethoxycarbonylcyclohex-3-en-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 44550407 |
| Molecular Formula | C20H21NO10 |
| Molecular Weight | 435.39 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | [(1S,5R,6S)-5,6-diacetyloxy-3-ethoxycarbonylcyclohex-3-en-1-yl] 4-nitrobenzoate |
| SMILES | CCOC(=O)C1=C[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C20H21NO10/c1-4-28-19(24)14-9-16(29-11(2)22)18(30-12(3)23)17(10-14)31-20(25)13-5-7-15(8-6-13)21(26)27/h5-9,16-18H,4,10H2,1-3H3/t16-,17+,18-/m1/s1 |
| InChIKey | OMUOMTRKTNXYSZ-FGTMMUONSA-N |
| XLogP | 1.88 |
| TPSA | 148.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|