About ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane
ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane (PubChem CID 159079628) has the molecular formula C21H32N2O7
and a molecular weight of 424.49 g/mol. Its IUPAC name is ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane.
Molecular Properties
| Compound Name | ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane |
| PubChem CID | 159079628 |
| Molecular Formula | C21H32N2O7 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane |
| SMILES | C.C.C.CCOC(=O)c1ccc(NO)cc1.CCOC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H9NO4.C9H11NO3.3CH4/c1-2-14-9(11)7-3-5-8(6-4-7)10(12)13;1-2-13-9(11)7-3-5-8(10-12)6-4-7;;;/h3-6H,2H2,1H3;3-6,10,12H,2H2,1H3;3*1H4 |
| InChIKey | KARQPZOXLZCKJP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane?
The IUPAC name of ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane (CID 159079628) is ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane.
What is the SMILES notation for ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane?
The canonical SMILES for ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane is C.C.C.CCOC(=O)c1ccc(NO)cc1.CCOC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane?
The InChIKey is KARQPZOXLZCKJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO4.C9H11NO3.3CH4/c1-2-14-9(11)7-3-5-8(6-4-7)10(12)13;1-2-13-9(11)7-3-5-8(10-12)6-4-7;;;/h3-6H,2H2,1H3;3-6,10,12H,2H2,1H3;3*1H4.
What are the key properties of ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane?
ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane has a molecular weight of 424.49 g/mol, XLogP of 5.34, 6 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(hydroxyamino)benzoate;ethyl 4-nitrobenzoate;methane is sourced from PubChem (CID 159079628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).