C17H21NO4 — CID 12614976
(5-methyl-2-prop-1-en-2-ylcyclohexyl) 4-nitrobenzoate (PubChem CID 12614976) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is (5-methyl-2-prop-1-en-2-ylcyclohexyl) 4-nitrobenzoate.
| Compound Name | (5-methyl-2-prop-1-en-2-ylcyclohexyl) 4-nitrobenzoate |
|---|---|
| PubChem CID | 12614976 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | (5-methyl-2-prop-1-en-2-ylcyclohexyl) 4-nitrobenzoate |
| SMILES | C=C(C)C1CCC(C)CC1OC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H21NO4/c1-11(2)15-9-4-12(3)10-16(15)22-17(19)13-5-7-14(8-6-13)18(20)21/h5-8,12,15-16H,1,4,9-10H2,2-3H3 |
| InChIKey | ZILCMLGGVRKUIN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|