C21H22N2O8 — CID 101199080
[(1S,2S,4R)-2-(4-methoxyphenoxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate (PubChem CID 101199080) has the molecular formula C21H22N2O8 and a molecular weight of 430.41 g/mol. Its IUPAC name is [(1S,2S,4R)-2-(4-methoxyphenoxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate.
| Compound Name | [(1S,2S,4R)-2-(4-methoxyphenoxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 101199080 |
| Molecular Formula | C21H22N2O8 |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [(1S,2S,4R)-2-(4-methoxyphenoxy)-4-methylcyclohexyl] 3,5-dinitrobenzoate |
| SMILES | COc1ccc(O[C@H]2C[C@H](C)CC[C@@H]2OC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C21H22N2O8/c1-13-3-8-19(20(9-13)30-18-6-4-17(29-2)5-7-18)31-21(24)14-10-15(22(25)26)12-16(11-14)23(27)28/h4-7,10-13,19-20H,3,8-9H2,1-2H3/t13-,19+,20+/m1/s1 |
| InChIKey | IYHDGMABXPXTIF-CWVNLOTRSA-N |
| XLogP | 4.30 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|