C19H14N2O7 — CID 101092690
[(E)-5-(4-methoxyphenyl)pent-2-en-4-ynyl] 3,5-dinitrobenzoate (PubChem CID 101092690) has the molecular formula C19H14N2O7 and a molecular weight of 382.33 g/mol. Its IUPAC name is [(E)-5-(4-methoxyphenyl)pent-2-en-4-ynyl] 3,5-dinitrobenzoate.
| Compound Name | [(E)-5-(4-methoxyphenyl)pent-2-en-4-ynyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 101092690 |
| Molecular Formula | C19H14N2O7 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | [(E)-5-(4-methoxyphenyl)pent-2-en-4-ynyl] 3,5-dinitrobenzoate |
| SMILES | COc1ccc(C#C/C=C/COC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C19H14N2O7/c1-27-18-8-6-14(7-9-18)5-3-2-4-10-28-19(22)15-11-16(20(23)24)13-17(12-15)21(25)26/h2,4,6-9,11-13H,10H2,1H3/b4-2+ |
| InChIKey | JQJWSPRWPLPYBG-DUXPYHPUSA-N |
| XLogP | 3.28 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|