C24H21N3O7 — CID 151895809
6-(6-cyanonaphthalen-2-yl)oxyhexyl 3,5-dinitrobenzoate (PubChem CID 151895809) has the molecular formula C24H21N3O7 and a molecular weight of 463.45 g/mol. Its IUPAC name is 6-(6-cyanonaphthalen-2-yl)oxyhexyl 3,5-dinitrobenzoate.
| Compound Name | 6-(6-cyanonaphthalen-2-yl)oxyhexyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 151895809 |
| Molecular Formula | C24H21N3O7 |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 6-(6-cyanonaphthalen-2-yl)oxyhexyl 3,5-dinitrobenzoate |
| SMILES | N#Cc1ccc2cc(OCCCCCCOC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)ccc2c1 |
| InChI | InChI=1S/C24H21N3O7/c25-16-17-5-6-19-14-23(8-7-18(19)11-17)33-9-3-1-2-4-10-34-24(28)20-12-21(26(29)30)15-22(13-20)27(31)32/h5-8,11-15H,1-4,9-10H2 |
| InChIKey | SRRPAJMDWLCXKC-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 145.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|