C28H36N2O7 — CID 139674276
6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dinitrobenzoate (PubChem CID 139674276) has the molecular formula C28H36N2O7 and a molecular weight of 512.60 g/mol. Its IUPAC name is 6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dinitrobenzoate.
| Compound Name | 6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139674276 |
| Molecular Formula | C28H36N2O7 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | 6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dinitrobenzoate |
| SMILES | CCCC1CCC(c2ccc(OCCCCCCOC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)CC1 |
| InChI | InChI=1S/C28H36N2O7/c1-2-7-21-8-10-22(11-9-21)23-12-14-27(15-13-23)36-16-5-3-4-6-17-37-28(31)24-18-25(29(32)33)20-26(19-24)30(34)35/h12-15,18-22H,2-11,16-17H2,1H3 |
| InChIKey | QWQYVGIPFNBWRR-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|