C28H38O5 — CID 135232125
6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dihydroxybenzoate (PubChem CID 135232125) has the molecular formula C28H38O5 and a molecular weight of 454.61 g/mol. Its IUPAC name is 6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dihydroxybenzoate.
| Compound Name | 6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 135232125 |
| Molecular Formula | C28H38O5 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 6-[4-(4-propylcyclohexyl)phenoxy]hexyl 3,5-dihydroxybenzoate |
| SMILES | CCCC1CCC(c2ccc(OCCCCCCOC(=O)c3cc(O)cc(O)c3)cc2)CC1 |
| InChI | InChI=1S/C28H38O5/c1-2-7-21-8-10-22(11-9-21)23-12-14-27(15-13-23)32-16-5-3-4-6-17-33-28(31)24-18-25(29)20-26(30)19-24/h12-15,18-22,29-30H,2-11,16-17H2,1H3 |
| InChIKey | NIVFYRJJSXKACP-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|