C34H37N3O8 — CID 59839113
6-[4-[(Z)-2-cyano-2-(4-hexoxyphenyl)ethenyl]phenoxy]hexyl 3,5-dinitrobenzoate (PubChem CID 59839113) has the molecular formula C34H37N3O8 and a molecular weight of 615.68 g/mol. Its IUPAC name is 6-[4-[(Z)-2-cyano-2-(4-hexoxyphenyl)ethenyl]phenoxy]hexyl 3,5-dinitrobenzoate.
| Compound Name | 6-[4-[(Z)-2-cyano-2-(4-hexoxyphenyl)ethenyl]phenoxy]hexyl 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 59839113 |
| Molecular Formula | C34H37N3O8 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | 6-[4-[(Z)-2-cyano-2-(4-hexoxyphenyl)ethenyl]phenoxy]hexyl 3,5-dinitrobenzoate |
| SMILES | CCCCCCOc1ccc(/C(C#N)=C/c2ccc(OCCCCCCOC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C34H37N3O8/c1-2-3-4-7-18-44-33-16-12-27(13-17-33)29(25-35)21-26-10-14-32(15-11-26)43-19-8-5-6-9-20-45-34(38)28-22-30(36(39)40)24-31(23-28)37(41)42/h10-17,21-24H,2-9,18-20H2,1H3/b29-21+ |
| InChIKey | YAUKPHUEEZEFJV-XHLNEMQHSA-N |
| XLogP | 8.32 |
| TPSA | 154.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|