C25H31NO3 — CID 123420265
3-(3,5-dimethoxyphenyl)-2-(4-octoxyphenyl)prop-2-enenitrile (PubChem CID 123420265) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-2-(4-octoxyphenyl)prop-2-enenitrile.
| Compound Name | 3-(3,5-dimethoxyphenyl)-2-(4-octoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 123420265 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-2-(4-octoxyphenyl)prop-2-enenitrile |
| SMILES | CCCCCCCCOc1ccc(C(C#N)=Cc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C25H31NO3/c1-4-5-6-7-8-9-14-29-23-12-10-21(11-13-23)22(19-26)15-20-16-24(27-2)18-25(17-20)28-3/h10-13,15-18H,4-9,14H2,1-3H3 |
| InChIKey | HWGHLQSAMIBVHZ-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|