C46H42N4O2 — CID 177473201
(E)-3-(4-butoxyphenyl)-2-[4-[[4-[[4-[(Z)-2-(4-butoxyphenyl)-1-cyanoethenyl]phenyl]iminomethyl]phenyl]methylideneamino]phenyl]prop-2-enenitrile (PubChem CID 177473201) has the molecular formula C46H42N4O2 and a molecular weight of 682.87 g/mol. Its IUPAC name is (E)-3-(4-butoxyphenyl)-2-[4-[[4-[[4-[(Z)-2-(4-butoxyphenyl)-1-cyanoethenyl]phenyl]iminomethyl]phenyl]methylideneamino]phenyl]prop-2-enenitrile.
| Compound Name | (E)-3-(4-butoxyphenyl)-2-[4-[[4-[[4-[(Z)-2-(4-butoxyphenyl)-1-cyanoethenyl]phenyl]iminomethyl]phenyl]methylideneamino]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 177473201 |
| Molecular Formula | C46H42N4O2 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.33 |
| IUPAC Name | (E)-3-(4-butoxyphenyl)-2-[4-[[4-[[4-[(Z)-2-(4-butoxyphenyl)-1-cyanoethenyl]phenyl]iminomethyl]phenyl]methylideneamino]phenyl]prop-2-enenitrile |
| SMILES | CCCCOc1ccc(/C=C(\C#N)c2ccc(/N=C/c3ccc(/C=N/c4ccc(/C(C#N)=C\c5ccc(OCCCC)cc5)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C46H42N4O2/c1-3-5-27-51-45-23-11-35(12-24-45)29-41(31-47)39-15-19-43(20-16-39)49-33-37-7-9-38(10-8-37)34-50-44-21-17-40(18-22-44)42(32-48)30-36-13-25-46(26-14-36)52-28-6-4-2/h7-26,29-30,33-34H,3-6,27-28H2,1-2H3/b41-29-,42-30+,49-33+,50-34+ |
| InChIKey | CRTQDNHKTLNITB-WOVLSEJZSA-N |
| XLogP | 11.67 |
| TPSA | 90.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|