C52H56N2O6 — CID 132967053
(Z)-3-[4-[(Z)-2-cyano-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]prop-2-enenitrile (PubChem CID 132967053) has the molecular formula C52H56N2O6 and a molecular weight of 805.03 g/mol. Its IUPAC name is (Z)-3-[4-[(Z)-2-cyano-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]prop-2-enenitrile.
| Compound Name | (Z)-3-[4-[(Z)-2-cyano-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 132967053 |
| Molecular Formula | C52H56N2O6 |
| Molecular Weight | 805.03 g/mol |
| Exact Mass | 804.41 |
| IUPAC Name | (Z)-3-[4-[(Z)-2-cyano-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]ethenyl]-2,5-dimethoxyphenyl]-2-[4-[6-(4-methylphenoxy)hexoxy]phenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)c2ccc(OCCCCCCOc3ccc(C)cc3)cc2)c(OC)cc1/C=C(\C#N)c1ccc(OCCCCCCOc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C52H56N2O6/c1-39-13-21-47(22-14-39)57-29-9-5-7-11-31-59-49-25-17-41(18-26-49)45(37-53)33-43-35-52(56-4)44(36-51(43)55-3)34-46(38-54)42-19-27-50(28-20-42)60-32-12-8-6-10-30-58-48-23-15-40(2)16-24-48/h13-28,33-36H,5-12,29-32H2,1-4H3/b45-33+,46-34+ |
| InChIKey | TWDMRWUZOWEVKE-NCOOAAOESA-N |
| XLogP | 12.49 |
| TPSA | 102.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.03 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|