C28H24N2O4 — CID 6005345
(Z)-2-[4-[(Z)-1-cyano-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]-3-(2,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 6005345) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is (Z)-2-[4-[(Z)-1-cyano-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]-3-(2,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-[4-[(Z)-1-cyano-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]-3-(2,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6005345 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (Z)-2-[4-[(Z)-1-cyano-2-(2,4-dimethoxyphenyl)ethenyl]phenyl]-3-(2,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(\C#N)c2ccc(/C(C#N)=C/c3ccc(OC)cc3OC)cc2)c(OC)c1 |
| InChI | InChI=1S/C28H24N2O4/c1-31-25-11-9-21(27(15-25)33-3)13-23(17-29)19-5-7-20(8-6-19)24(18-30)14-22-10-12-26(32-2)16-28(22)34-4/h5-16H,1-4H3/b23-13+,24-14+ |
| InChIKey | OZEUUMNXWGGPSJ-RNIAWFEPSA-N |
| XLogP | 5.85 |
| TPSA | 84.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|