C26H18Br2N2O2 — CID 118471873
2-(4-bromophenyl)-3-[4-[2-(4-bromophenyl)-2-cyanoethenyl]-2,5-dimethoxyphenyl]prop-2-enenitrile (PubChem CID 118471873) has the molecular formula C26H18Br2N2O2 and a molecular weight of 550.25 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-[4-[2-(4-bromophenyl)-2-cyanoethenyl]-2,5-dimethoxyphenyl]prop-2-enenitrile.
| Compound Name | 2-(4-bromophenyl)-3-[4-[2-(4-bromophenyl)-2-cyanoethenyl]-2,5-dimethoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 118471873 |
| Molecular Formula | C26H18Br2N2O2 |
| Molecular Weight | 550.25 g/mol |
| Exact Mass | 547.97 |
| IUPAC Name | 2-(4-bromophenyl)-3-[4-[2-(4-bromophenyl)-2-cyanoethenyl]-2,5-dimethoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)c2ccc(Br)cc2)c(OC)cc1C=C(C#N)c1ccc(Br)cc1 |
| InChI | InChI=1S/C26H18Br2N2O2/c1-31-25-13-20(12-22(16-30)18-5-9-24(28)10-6-18)26(32-2)14-19(25)11-21(15-29)17-3-7-23(27)8-4-17/h3-14H,1-2H3 |
| InChIKey | YCVVDPOMFHIKMB-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.25 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|