C17H13BrFNO2 — CID 1248232
(Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(4-fluorophenyl)prop-2-enenitrile (PubChem CID 1248232) has the molecular formula C17H13BrFNO2 and a molecular weight of 362.20 g/mol. Its IUPAC name is (Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(4-fluorophenyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(4-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1248232 |
| Molecular Formula | C17H13BrFNO2 |
| Molecular Weight | 362.20 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | (Z)-3-(5-bromo-2,4-dimethoxyphenyl)-2-(4-fluorophenyl)prop-2-enenitrile |
| SMILES | COc1cc(OC)c(/C=C(\C#N)c2ccc(F)cc2)cc1Br |
| InChI | InChI=1S/C17H13BrFNO2/c1-21-16-9-17(22-2)15(18)8-12(16)7-13(10-20)11-3-5-14(19)6-4-11/h3-9H,1-2H3/b13-7+ |
| InChIKey | RJTGFFKJYZFURC-NTUHNPAUSA-N |
| XLogP | 4.67 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.20 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|