C19H17BrFNO2 — CID 126398407
(E)-3-(5-bromo-2,4-diethoxyphenyl)-2-(3-fluorophenyl)prop-2-enenitrile (PubChem CID 126398407) has the molecular formula C19H17BrFNO2 and a molecular weight of 390.25 g/mol. Its IUPAC name is (E)-3-(5-bromo-2,4-diethoxyphenyl)-2-(3-fluorophenyl)prop-2-enenitrile.
| Compound Name | (E)-3-(5-bromo-2,4-diethoxyphenyl)-2-(3-fluorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 126398407 |
| Molecular Formula | C19H17BrFNO2 |
| Molecular Weight | 390.25 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | (E)-3-(5-bromo-2,4-diethoxyphenyl)-2-(3-fluorophenyl)prop-2-enenitrile |
| SMILES | CCOc1cc(OCC)c(/C=C(/C#N)c2cccc(F)c2)cc1Br |
| InChI | InChI=1S/C19H17BrFNO2/c1-3-23-18-11-19(24-4-2)17(20)10-14(18)8-15(12-22)13-6-5-7-16(21)9-13/h5-11H,3-4H2,1-2H3/b15-8- |
| InChIKey | STDSGVLYQOPYFS-NVNXTCNLSA-N |
| XLogP | 5.45 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.25 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|