C16H12BrNO4 — CID 134867709
(E)-2-(4-bromophenyl)-3-(3,4,5-trihydroxy-2-methoxyphenyl)prop-2-enenitrile (PubChem CID 134867709) has the molecular formula C16H12BrNO4 and a molecular weight of 362.18 g/mol. Its IUPAC name is (E)-2-(4-bromophenyl)-3-(3,4,5-trihydroxy-2-methoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(4-bromophenyl)-3-(3,4,5-trihydroxy-2-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 134867709 |
| Molecular Formula | C16H12BrNO4 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | (E)-2-(4-bromophenyl)-3-(3,4,5-trihydroxy-2-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1c(/C=C(/C#N)c2ccc(Br)cc2)cc(O)c(O)c1O |
| InChI | InChI=1S/C16H12BrNO4/c1-22-16-10(7-13(19)14(20)15(16)21)6-11(8-18)9-2-4-12(17)5-3-9/h2-7,19-21H,1H3/b11-6- |
| InChIKey | FFUQOPOKRGNLOY-WDZFZDKYSA-N |
| XLogP | 3.64 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|