C15H8BrCl2N — CID 3302131
2-(4-bromophenyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 3302131) has the molecular formula C15H8BrCl2N and a molecular weight of 353.05 g/mol. Its IUPAC name is 2-(4-bromophenyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | 2-(4-bromophenyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3302131 |
| Molecular Formula | C15H8BrCl2N |
| Molecular Weight | 353.05 g/mol |
| Exact Mass | 350.92 |
| IUPAC Name | 2-(4-bromophenyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Cl)cc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H8BrCl2N/c16-13-4-1-10(2-5-13)12(9-19)7-11-3-6-14(17)8-15(11)18/h1-8H |
| InChIKey | RWWJQPBYPWAAPY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.05 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|