C15H7Br2Cl2NO2S — CID 3287321
2-(2,5-dibromophenyl)sulfonyl-3-(2,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 3287321) has the molecular formula C15H7Br2Cl2NO2S and a molecular weight of 496.01 g/mol. Its IUPAC name is 2-(2,5-dibromophenyl)sulfonyl-3-(2,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | 2-(2,5-dibromophenyl)sulfonyl-3-(2,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3287321 |
| Molecular Formula | C15H7Br2Cl2NO2S |
| Molecular Weight | 496.01 g/mol |
| Exact Mass | 492.79 |
| IUPAC Name | 2-(2,5-dibromophenyl)sulfonyl-3-(2,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H7Br2Cl2NO2S/c16-10-2-4-13(17)15(6-10)23(21,22)12(8-20)5-9-1-3-11(18)7-14(9)19/h1-7H |
| InChIKey | VMRCDXKEZAGMOJ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.01 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|