C16H10BrCl2NO2S — CID 68943895
3-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile (PubChem CID 68943895) has the molecular formula C16H10BrCl2NO2S and a molecular weight of 431.14 g/mol. Its IUPAC name is 3-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile.
| Compound Name | 3-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 68943895 |
| Molecular Formula | C16H10BrCl2NO2S |
| Molecular Weight | 431.14 g/mol |
| Exact Mass | 428.90 |
| IUPAC Name | 3-(4-bromophenyl)-2-[(2,4-dichlorophenyl)methylsulfonyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Br)cc1)S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H10BrCl2NO2S/c17-13-4-1-11(2-5-13)7-15(9-20)23(21,22)10-12-3-6-14(18)8-16(12)19/h1-8H,10H2 |
| InChIKey | LXTGLQLJHHMNRZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.14 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|