C15H11Cl2NO2S2 — CID 68948574
(Z)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile (PubChem CID 68948574) has the molecular formula C15H11Cl2NO2S2 and a molecular weight of 372.30 g/mol. Its IUPAC name is (Z)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68948574 |
| Molecular Formula | C15H11Cl2NO2S2 |
| Molecular Weight | 372.30 g/mol |
| Exact Mass | 370.96 |
| IUPAC Name | (Z)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(5-methylthiophen-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C=C(/C#N)S(=O)(=O)Cc2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C15H11Cl2NO2S2/c1-10-2-5-13(21-10)7-14(8-18)22(19,20)9-11-3-4-12(16)6-15(11)17/h2-7H,9H2,1H3/b14-7- |
| InChIKey | JYGQCLSISVBWRS-AUWJEWJLSA-N |
| XLogP | 4.84 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|