C16H11Cl2NO3S — CID 68946884
2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2-hydroxyphenyl)prop-2-enenitrile (PubChem CID 68946884) has the molecular formula C16H11Cl2NO3S and a molecular weight of 368.24 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2-hydroxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2-hydroxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68946884 |
| Molecular Formula | C16H11Cl2NO3S |
| Molecular Weight | 368.24 g/mol |
| Exact Mass | 366.98 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(2-hydroxyphenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccccc1O)S(=O)(=O)Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2NO3S/c17-13-6-5-12(15(18)8-13)10-23(21,22)14(9-19)7-11-3-1-2-4-16(11)20/h1-8,20H,10H2 |
| InChIKey | IYAQEENXBWJNRH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|