C18H15Cl2NO2S — CID 68940920
(E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(3,4-dimethylphenyl)prop-2-enenitrile (PubChem CID 68940920) has the molecular formula C18H15Cl2NO2S and a molecular weight of 380.30 g/mol. Its IUPAC name is (E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(3,4-dimethylphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(3,4-dimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68940920 |
| Molecular Formula | C18H15Cl2NO2S |
| Molecular Weight | 380.30 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | (E)-2-[(2,4-dichlorophenyl)methylsulfonyl]-3-(3,4-dimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(/C=C(\C#N)S(=O)(=O)Cc2ccc(Cl)cc2Cl)cc1C |
| InChI | InChI=1S/C18H15Cl2NO2S/c1-12-3-4-14(7-13(12)2)8-17(10-21)24(22,23)11-15-5-6-16(19)9-18(15)20/h3-9H,11H2,1-2H3/b17-8+ |
| InChIKey | UEHHAWSIBWBYNR-CAOOACKPSA-N |
| XLogP | 5.09 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|