C17H14ClNO4S — CID 68945199
2-[(4-chlorophenyl)methylsulfonyl]-3-(3-hydroxy-4-methoxyphenyl)prop-2-enenitrile (PubChem CID 68945199) has the molecular formula C17H14ClNO4S and a molecular weight of 363.82 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methylsulfonyl]-3-(3-hydroxy-4-methoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-[(4-chlorophenyl)methylsulfonyl]-3-(3-hydroxy-4-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68945199 |
| Molecular Formula | C17H14ClNO4S |
| Molecular Weight | 363.82 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 2-[(4-chlorophenyl)methylsulfonyl]-3-(3-hydroxy-4-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(C=C(C#N)S(=O)(=O)Cc2ccc(Cl)cc2)cc1O |
| InChI | InChI=1S/C17H14ClNO4S/c1-23-17-7-4-13(9-16(17)20)8-15(10-19)24(21,22)11-12-2-5-14(18)6-3-12/h2-9,20H,11H2,1H3 |
| InChIKey | ZFOWNASSAJFOIY-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.82 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|