C18H17NO4S — CID 25052505
(E)-2-benzylsulfonyl-3-(3,5-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 25052505) has the molecular formula C18H17NO4S and a molecular weight of 343.40 g/mol. Its IUPAC name is (E)-2-benzylsulfonyl-3-(3,5-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-benzylsulfonyl-3-(3,5-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 25052505 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (E)-2-benzylsulfonyl-3-(3,5-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)S(=O)(=O)Cc2ccccc2)cc(OC)c1 |
| InChI | InChI=1S/C18H17NO4S/c1-22-16-8-15(9-17(11-16)23-2)10-18(12-19)24(20,21)13-14-6-4-3-5-7-14/h3-11H,13H2,1-2H3/b18-10+ |
| InChIKey | WJSBPMWDWMKRER-VCHYOVAHSA-N |
| XLogP | 3.18 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|