C19H18ClNO5S — CID 68949487
(E)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 68949487) has the molecular formula C19H18ClNO5S and a molecular weight of 407.88 g/mol. Its IUPAC name is (E)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 68949487 |
| Molecular Formula | C19H18ClNO5S |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (E)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(OC)c(/C=C(\C#N)S(=O)(=O)Cc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C19H18ClNO5S/c1-24-15-8-18(25-2)17(19(9-15)26-3)10-16(11-21)27(22,23)12-13-4-6-14(20)7-5-13/h4-10H,12H2,1-3H3/b16-10+ |
| InChIKey | JCKSBCXMNXOSSP-MHWRWJLKSA-N |
| XLogP | 3.85 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|