C19H21NO8S — CID 68940905
1,3,5-trimethoxy-2-[2-[(4-methoxyphenyl)methylsulfonyl]-2-nitroethenyl]benzene (PubChem CID 68940905) has the molecular formula C19H21NO8S and a molecular weight of 423.44 g/mol. Its IUPAC name is 1,3,5-trimethoxy-2-[2-[(4-methoxyphenyl)methylsulfonyl]-2-nitroethenyl]benzene.
| Compound Name | 1,3,5-trimethoxy-2-[2-[(4-methoxyphenyl)methylsulfonyl]-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 68940905 |
| Molecular Formula | C19H21NO8S |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.10 |
| IUPAC Name | 1,3,5-trimethoxy-2-[2-[(4-methoxyphenyl)methylsulfonyl]-2-nitroethenyl]benzene |
| SMILES | COc1ccc(CS(=O)(=O)C(=Cc2c(OC)cc(OC)cc2OC)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H21NO8S/c1-25-14-7-5-13(6-8-14)12-29(23,24)19(20(21)22)11-16-17(27-3)9-15(26-2)10-18(16)28-4/h5-11H,12H2,1-4H3 |
| InChIKey | FJSJOIRKMJHWHJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 114.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|