C25H22BrClO6S — CID 68539363
1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 68539363) has the molecular formula C25H22BrClO6S and a molecular weight of 565.87 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68539363 |
| Molecular Formula | C25H22BrClO6S |
| Molecular Weight | 565.87 g/mol |
| Exact Mass | 564.00 |
| IUPAC Name | 1-(4-bromophenyl)-2-[(4-chlorophenyl)methylsulfonyl]-3-(2,4,6-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(OC)c(C=C(C(=O)c2ccc(Br)cc2)S(=O)(=O)Cc2ccc(Cl)cc2)c(OC)c1 |
| InChI | InChI=1S/C25H22BrClO6S/c1-31-20-12-22(32-2)21(23(13-20)33-3)14-24(25(28)17-6-8-18(26)9-7-17)34(29,30)15-16-4-10-19(27)11-5-16/h4-14H,15H2,1-3H3 |
| InChIKey | LXIIBSYUVGCBHV-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.87 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|