C22H14Br2Cl2O4S — CID 68539584
1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-en-1-one (PubChem CID 68539584) has the molecular formula C22H14Br2Cl2O4S and a molecular weight of 605.13 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68539584 |
| Molecular Formula | C22H14Br2Cl2O4S |
| Molecular Weight | 605.13 g/mol |
| Exact Mass | 601.84 |
| IUPAC Name | 1-(4-bromophenyl)-2-[(4-bromophenyl)methylsulfonyl]-3-(3,5-dichloro-4-hydroxyphenyl)prop-2-en-1-one |
| SMILES | O=C(C(=Cc1cc(Cl)c(O)c(Cl)c1)S(=O)(=O)Cc1ccc(Br)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H14Br2Cl2O4S/c23-16-5-1-13(2-6-16)12-31(29,30)20(21(27)15-3-7-17(24)8-4-15)11-14-9-18(25)22(28)19(26)10-14/h1-11,28H,12H2 |
| InChIKey | XEPQZOJCZZWNSW-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.13 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|