C22H15BrI2O3S — CID 68540283
1-(4-bromophenyl)-3-(4-iodophenyl)-2-[(4-iodophenyl)methylsulfonyl]prop-2-en-1-one (PubChem CID 68540283) has the molecular formula C22H15BrI2O3S and a molecular weight of 693.14 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-(4-iodophenyl)-2-[(4-iodophenyl)methylsulfonyl]prop-2-en-1-one.
| Compound Name | 1-(4-bromophenyl)-3-(4-iodophenyl)-2-[(4-iodophenyl)methylsulfonyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68540283 |
| Molecular Formula | C22H15BrI2O3S |
| Molecular Weight | 693.14 g/mol |
| Exact Mass | 691.80 |
| IUPAC Name | 1-(4-bromophenyl)-3-(4-iodophenyl)-2-[(4-iodophenyl)methylsulfonyl]prop-2-en-1-one |
| SMILES | O=C(C(=Cc1ccc(I)cc1)S(=O)(=O)Cc1ccc(I)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H15BrI2O3S/c23-18-7-5-17(6-8-18)22(26)21(13-15-1-9-19(24)10-2-15)29(27,28)14-16-3-11-20(25)12-4-16/h1-13H,14H2 |
| InChIKey | FKSNFXQHSFZKKX-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.14 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|