C22H16Br2O3S — CID 57396861
(E)-2-benzylsulfonyl-1,3-bis(4-bromophenyl)prop-2-en-1-one (PubChem CID 57396861) has the molecular formula C22H16Br2O3S and a molecular weight of 520.24 g/mol. Its IUPAC name is (E)-2-benzylsulfonyl-1,3-bis(4-bromophenyl)prop-2-en-1-one.
| Compound Name | (E)-2-benzylsulfonyl-1,3-bis(4-bromophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57396861 |
| Molecular Formula | C22H16Br2O3S |
| Molecular Weight | 520.24 g/mol |
| Exact Mass | 517.92 |
| IUPAC Name | (E)-2-benzylsulfonyl-1,3-bis(4-bromophenyl)prop-2-en-1-one |
| SMILES | O=C(/C(=C\c1ccc(Br)cc1)S(=O)(=O)Cc1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C22H16Br2O3S/c23-19-10-6-16(7-11-19)14-21(22(25)18-8-12-20(24)13-9-18)28(26,27)15-17-4-2-1-3-5-17/h1-14H,15H2/b21-14+ |
| InChIKey | GSYQVBJRQRBPBF-KGENOOAVSA-N |
| XLogP | 6.05 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.24 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|