C25H19BrClNO3S — CID 68543701
3-(5-bromo-1H-indol-3-yl)-1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one (PubChem CID 68543701) has the molecular formula C25H19BrClNO3S and a molecular weight of 528.86 g/mol. Its IUPAC name is 3-(5-bromo-1H-indol-3-yl)-1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one.
| Compound Name | 3-(5-bromo-1H-indol-3-yl)-1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 68543701 |
| Molecular Formula | C25H19BrClNO3S |
| Molecular Weight | 528.86 g/mol |
| Exact Mass | 527.00 |
| IUPAC Name | 3-(5-bromo-1H-indol-3-yl)-1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]prop-2-en-1-one |
| SMILES | Cc1ccc(CS(=O)(=O)C(=Cc2c[nH]c3ccc(Br)cc23)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C25H19BrClNO3S/c1-16-2-4-17(5-3-16)15-32(30,31)24(25(29)18-6-9-21(27)10-7-18)12-19-14-28-23-11-8-20(26)13-22(19)23/h2-14,28H,15H2,1H3 |
| InChIKey | JGRQJJSAVBZHLI-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 67.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.86 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|