C22H19ClO3S2 — CID 68539814
1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one (PubChem CID 68539814) has the molecular formula C22H19ClO3S2 and a molecular weight of 430.98 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one.
| Compound Name | 1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 68539814 |
| Molecular Formula | C22H19ClO3S2 |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | 1-(4-chlorophenyl)-2-[(4-methylphenyl)methylsulfonyl]-3-(3-methylthiophen-2-yl)prop-2-en-1-one |
| SMILES | Cc1ccc(CS(=O)(=O)C(=Cc2sccc2C)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H19ClO3S2/c1-15-3-5-17(6-4-15)14-28(25,26)21(13-20-16(2)11-12-27-20)22(24)18-7-9-19(23)10-8-18/h3-13H,14H2,1-2H3 |
| InChIKey | LSYIDELFSJQCFU-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|