C22H16Cl2O3S — CID 155812790
(Z)-1,3-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one (PubChem CID 155812790) has the molecular formula C22H16Cl2O3S and a molecular weight of 431.34 g/mol. Its IUPAC name is (Z)-1,3-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one.
| Compound Name | (Z)-1,3-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one |
|---|---|
| PubChem CID | 155812790 |
| Molecular Formula | C22H16Cl2O3S |
| Molecular Weight | 431.34 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | (Z)-1,3-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one |
| SMILES | Cc1ccc(S(=O)(=O)/C(=C\c2ccc(Cl)cc2)C(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H16Cl2O3S/c1-15-2-12-20(13-3-15)28(26,27)21(14-16-4-8-18(23)9-5-16)22(25)17-6-10-19(24)11-7-17/h2-14H,1H3/b21-14- |
| InChIKey | VULZGRXWUSSOSH-STZFKDTASA-N |
| XLogP | 6.00 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.34 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|