C25H23ClO5S — CID 52949112
(E)-1-(4-chlorophenyl)-3-(4-ethoxy-3-methoxyphenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one (PubChem CID 52949112) has the molecular formula C25H23ClO5S and a molecular weight of 470.97 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-(4-ethoxy-3-methoxyphenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-3-(4-ethoxy-3-methoxyphenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one |
|---|---|
| PubChem CID | 52949112 |
| Molecular Formula | C25H23ClO5S |
| Molecular Weight | 470.97 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-(4-ethoxy-3-methoxyphenyl)-2-(4-methylphenyl)sulfonylprop-2-en-1-one |
| SMILES | CCOc1ccc(/C=C(\C(=O)c2ccc(Cl)cc2)S(=O)(=O)c2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C25H23ClO5S/c1-4-31-22-14-7-18(15-23(22)30-3)16-24(25(27)19-8-10-20(26)11-9-19)32(28,29)21-12-5-17(2)6-13-21/h5-16H,4H2,1-3H3/b24-16+ |
| InChIKey | YCIBUMAXHKKKRZ-LFVJCYFKSA-N |
| XLogP | 5.75 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|