C19H20FNO5S — CID 68946173
3-(4-ethoxy-3-methoxyphenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide (PubChem CID 68946173) has the molecular formula C19H20FNO5S and a molecular weight of 393.44 g/mol. Its IUPAC name is 3-(4-ethoxy-3-methoxyphenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide.
| Compound Name | 3-(4-ethoxy-3-methoxyphenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide |
|---|---|
| PubChem CID | 68946173 |
| Molecular Formula | C19H20FNO5S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 3-(4-ethoxy-3-methoxyphenyl)-2-[(4-fluorophenyl)methylsulfonyl]prop-2-enamide |
| SMILES | CCOc1ccc(C=C(C(N)=O)S(=O)(=O)Cc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C19H20FNO5S/c1-3-26-16-9-6-14(10-17(16)25-2)11-18(19(21)22)27(23,24)12-13-4-7-15(20)8-5-13/h4-11H,3,12H2,1-2H3,(H2,21,22) |
| InChIKey | KAMRJOBJAANQKE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|