C17H11F5N2O6S — CID 87630917
(E)-2-[(4-methoxy-3-nitrophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide (PubChem CID 87630917) has the molecular formula C17H11F5N2O6S and a molecular weight of 466.34 g/mol. Its IUPAC name is (E)-2-[(4-methoxy-3-nitrophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide.
| Compound Name | (E)-2-[(4-methoxy-3-nitrophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 87630917 |
| Molecular Formula | C17H11F5N2O6S |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 466.03 |
| IUPAC Name | (E)-2-[(4-methoxy-3-nitrophenyl)methylsulfonyl]-3-(2,3,4,5,6-pentafluorophenyl)prop-2-enamide |
| SMILES | COc1ccc(CS(=O)(=O)/C(=C/c2c(F)c(F)c(F)c(F)c2F)C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11F5N2O6S/c1-30-10-3-2-7(4-9(10)24(26)27)6-31(28,29)11(17(23)25)5-8-12(18)14(20)16(22)15(21)13(8)19/h2-5H,6H2,1H3,(H2,23,25)/b11-5+ |
| InChIKey | UZSLWNGVUKRTFB-VZUCSPMQSA-N |
| XLogP | 2.74 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|