C15H7F5N2O7S — CID 87631449
1,2,3,4,5-pentafluoro-6-[(E)-2-(4-methoxy-3-nitrophenyl)sulfonyl-2-nitroethenyl]benzene (PubChem CID 87631449) has the molecular formula C15H7F5N2O7S and a molecular weight of 454.29 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-[(E)-2-(4-methoxy-3-nitrophenyl)sulfonyl-2-nitroethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-[(E)-2-(4-methoxy-3-nitrophenyl)sulfonyl-2-nitroethenyl]benzene |
|---|---|
| PubChem CID | 87631449 |
| Molecular Formula | C15H7F5N2O7S |
| Molecular Weight | 454.29 g/mol |
| Exact Mass | 453.99 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-[(E)-2-(4-methoxy-3-nitrophenyl)sulfonyl-2-nitroethenyl]benzene |
| SMILES | COc1ccc(S(=O)(=O)/C(=C/c2c(F)c(F)c(F)c(F)c2F)[N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H7F5N2O7S/c1-29-9-3-2-6(4-8(9)21(23)24)30(27,28)10(22(25)26)5-7-11(16)13(18)15(20)14(19)12(7)17/h2-5H,1H3/b10-5+ |
| InChIKey | LDLULMODADLENF-BJMVGYQFSA-N |
| XLogP | 3.35 |
| TPSA | 129.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|