C9H6F6N2O7S2 — CID 154774344
1,1,1-trifluoro-N-(4-methoxy-3-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide (PubChem CID 154774344) has the molecular formula C9H6F6N2O7S2 and a molecular weight of 432.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(4-methoxy-3-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(4-methoxy-3-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide |
|---|---|
| PubChem CID | 154774344 |
| Molecular Formula | C9H6F6N2O7S2 |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.95 |
| IUPAC Name | 1,1,1-trifluoro-N-(4-methoxy-3-nitrophenyl)-N-(trifluoromethylsulfonyl)methanesulfonamide |
| SMILES | COc1ccc(N(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6F6N2O7S2/c1-24-7-3-2-5(4-6(7)16(18)19)17(25(20,21)8(10,11)12)26(22,23)9(13,14)15/h2-4H,1H3 |
| InChIKey | ZTUJYBFSFGPUEO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 123.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|