C17H12F5NO4S — CID 91190229
1-[2-[(3,4-dimethoxyphenyl)methylsulfanyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene (PubChem CID 91190229) has the molecular formula C17H12F5NO4S and a molecular weight of 421.34 g/mol. Its IUPAC name is 1-[2-[(3,4-dimethoxyphenyl)methylsulfanyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene.
| Compound Name | 1-[2-[(3,4-dimethoxyphenyl)methylsulfanyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene |
|---|---|
| PubChem CID | 91190229 |
| Molecular Formula | C17H12F5NO4S |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | 1-[2-[(3,4-dimethoxyphenyl)methylsulfanyl]-2-nitroethenyl]-2,3,4,5,6-pentafluorobenzene |
| SMILES | COc1ccc(CSC(=Cc2c(F)c(F)c(F)c(F)c2F)[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H12F5NO4S/c1-26-10-4-3-8(5-11(10)27-2)7-28-12(23(24)25)6-9-13(18)15(20)17(22)16(21)14(9)19/h3-6H,7H2,1-2H3 |
| InChIKey | BFJYPRAFOJMVSE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|