C18H18N2O6 — CID 88595164
4-[(E)-4-(3,5-dinitrophenyl)but-3-enyl]-1,2-dimethoxybenzene (PubChem CID 88595164) has the molecular formula C18H18N2O6 and a molecular weight of 358.35 g/mol. Its IUPAC name is 4-[(E)-4-(3,5-dinitrophenyl)but-3-enyl]-1,2-dimethoxybenzene.
| Compound Name | 4-[(E)-4-(3,5-dinitrophenyl)but-3-enyl]-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 88595164 |
| Molecular Formula | C18H18N2O6 |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 4-[(E)-4-(3,5-dinitrophenyl)but-3-enyl]-1,2-dimethoxybenzene |
| SMILES | COc1ccc(CC/C=C/c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C18H18N2O6/c1-25-17-8-7-13(11-18(17)26-2)5-3-4-6-14-9-15(19(21)22)12-16(10-14)20(23)24/h4,6-12H,3,5H2,1-2H3/b6-4+ |
| InChIKey | WXIFUFOABZEVNJ-GQCTYLIASA-N |
| XLogP | 4.17 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|