C26H24N2O12S — CID 11433261
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-dinitrobenzoate (PubChem CID 11433261) has the molecular formula C26H24N2O12S and a molecular weight of 588.55 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-dinitrobenzoate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 11433261 |
| Molecular Formula | C26H24N2O12S |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-dinitrobenzoate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2)c(OC)c1 |
| InChI | InChI=1S/C26H24N2O12S/c1-36-20-13-23(38-3)21(24(14-20)39-4)7-8-41(34,35)15-16-5-6-22(37-2)25(9-16)40-26(29)17-10-18(27(30)31)12-19(11-17)28(32)33/h5-14H,15H2,1-4H3/b8-7+ |
| InChIKey | ZHZZKMRASRMIHM-BQYQJAHWSA-N |
| XLogP | 4.34 |
| TPSA | 183.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|