C26H26N2O8S — CID 10029831
N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-1-(4-nitrophenyl)methanimine (PubChem CID 10029831) has the molecular formula C26H26N2O8S and a molecular weight of 526.57 g/mol. Its IUPAC name is N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-1-(4-nitrophenyl)methanimine.
| Compound Name | N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-1-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 10029831 |
| Molecular Formula | C26H26N2O8S |
| Molecular Weight | 526.57 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | N-[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl]-1-(4-nitrophenyl)methanimine |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(/N=C/c3ccc([N+](=O)[O-])cc3)c2)c(OC)c1 |
| InChI | InChI=1S/C26H26N2O8S/c1-33-21-14-25(35-3)22(26(15-21)36-4)11-12-37(31,32)17-19-7-10-24(34-2)23(13-19)27-16-18-5-8-20(9-6-18)28(29)30/h5-16H,17H2,1-4H3/b12-11+,27-16+ |
| InChIKey | XUFBNFQWAALUGE-URYLQBCASA-N |
| XLogP | 4.97 |
| TPSA | 126.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.57 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|