C18H21NO5S — CID 54587451
5-[[(E)-2-(3,5-dimethoxyphenyl)ethenyl]sulfonylmethyl]-2-methoxyaniline (PubChem CID 54587451) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is 5-[[(E)-2-(3,5-dimethoxyphenyl)ethenyl]sulfonylmethyl]-2-methoxyaniline.
| Compound Name | 5-[[(E)-2-(3,5-dimethoxyphenyl)ethenyl]sulfonylmethyl]-2-methoxyaniline |
|---|---|
| PubChem CID | 54587451 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | 5-[[(E)-2-(3,5-dimethoxyphenyl)ethenyl]sulfonylmethyl]-2-methoxyaniline |
| SMILES | COc1cc(/C=C/S(=O)(=O)Cc2ccc(OC)c(N)c2)cc(OC)c1 |
| InChI | InChI=1S/C18H21NO5S/c1-22-15-8-13(9-16(11-15)23-2)6-7-25(20,21)12-14-4-5-18(24-3)17(19)10-14/h4-11H,12,19H2,1-3H3/b7-6+ |
| InChIKey | VMIQAQMSMUMUKP-VOTSOKGWSA-N |
| XLogP | 2.88 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|