C21H22F2O8S — CID 11751795
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2,2-difluoroacetate (PubChem CID 11751795) has the molecular formula C21H22F2O8S and a molecular weight of 472.46 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2,2-difluoroacetate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2,2-difluoroacetate |
|---|---|
| PubChem CID | 11751795 |
| Molecular Formula | C21H22F2O8S |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2,2-difluoroacetate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OC(=O)C(F)F)c2)c(OC)c1 |
| InChI | InChI=1S/C21H22F2O8S/c1-27-14-10-17(29-3)15(18(11-14)30-4)7-8-32(25,26)12-13-5-6-16(28-2)19(9-13)31-21(24)20(22)23/h5-11,20H,12H2,1-4H3/b8-7+ |
| InChIKey | IMQMOVZRYGUUOQ-BQYQJAHWSA-N |
| XLogP | 3.48 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|