C21H25O12PS — CID 87269961
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-phosphonooxyacetate (PubChem CID 87269961) has the molecular formula C21H25O12PS and a molecular weight of 532.46 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-phosphonooxyacetate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-phosphonooxyacetate |
|---|---|
| PubChem CID | 87269961 |
| Molecular Formula | C21H25O12PS |
| Molecular Weight | 532.46 g/mol |
| Exact Mass | 532.08 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-phosphonooxyacetate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OC(=O)COP(=O)(O)O)c2)c(OC)c1 |
| InChI | InChI=1S/C21H25O12PS/c1-28-15-10-18(30-3)16(19(11-15)31-4)7-8-35(26,27)13-14-5-6-17(29-2)20(9-14)33-21(22)12-32-34(23,24)25/h5-11H,12-13H2,1-4H3,(H2,23,24,25)/b8-7+ |
| InChIKey | IHDYNZIZEVNAIV-BQYQJAHWSA-N |
| XLogP | 2.32 |
| TPSA | 164.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|