C25H34N2O8S — CID 87270144
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] (2R)-2,6-diaminohexanoate (PubChem CID 87270144) has the molecular formula C25H34N2O8S and a molecular weight of 522.62 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] (2R)-2,6-diaminohexanoate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] (2R)-2,6-diaminohexanoate |
|---|---|
| PubChem CID | 87270144 |
| Molecular Formula | C25H34N2O8S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] (2R)-2,6-diaminohexanoate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OC(=O)[C@H](N)CCCCN)c2)c(OC)c1 |
| InChI | InChI=1S/C25H34N2O8S/c1-31-18-14-22(33-3)19(23(15-18)34-4)10-12-36(29,30)16-17-8-9-21(32-2)24(13-17)35-25(28)20(27)7-5-6-11-26/h8-10,12-15,20H,5-7,11,16,26-27H2,1-4H3/b12-10+/t20-/m1/s1 |
| InChIKey | MRMJZPLCPSKWMD-ZAHGZRRWSA-N |
| XLogP | 2.67 |
| TPSA | 149.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|