C26H28N2O8S — CID 11443926
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-diaminobenzoate (PubChem CID 11443926) has the molecular formula C26H28N2O8S and a molecular weight of 528.58 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-diaminobenzoate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-diaminobenzoate |
|---|---|
| PubChem CID | 11443926 |
| Molecular Formula | C26H28N2O8S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 3,5-diaminobenzoate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OC(=O)c3cc(N)cc(N)c3)c2)c(OC)c1 |
| InChI | InChI=1S/C26H28N2O8S/c1-32-20-13-23(34-3)21(24(14-20)35-4)7-8-37(30,31)15-16-5-6-22(33-2)25(9-16)36-26(29)17-10-18(27)12-19(28)11-17/h5-14H,15,27-28H2,1-4H3/b8-7+ |
| InChIKey | LMBVBCMAOJODHU-BQYQJAHWSA-N |
| XLogP | 3.69 |
| TPSA | 149.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|