C26H34N2O8S — CID 11364616
[2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate (PubChem CID 11364616) has the molecular formula C26H34N2O8S and a molecular weight of 534.63 g/mol. Its IUPAC name is [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate.
| Compound Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate |
|---|---|
| PubChem CID | 11364616 |
| Molecular Formula | C26H34N2O8S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | [2-methoxy-5-[[(E)-2-(2,4,6-trimethoxyphenyl)ethenyl]sulfonylmethyl]phenyl] 2-(4-methylpiperazin-1-yl)acetate |
| SMILES | COc1cc(OC)c(/C=C/S(=O)(=O)Cc2ccc(OC)c(OC(=O)CN3CCN(C)CC3)c2)c(OC)c1 |
| InChI | InChI=1S/C26H34N2O8S/c1-27-9-11-28(12-10-27)17-26(29)36-25-14-19(6-7-22(25)33-3)18-37(30,31)13-8-21-23(34-4)15-20(32-2)16-24(21)35-5/h6-8,13-16H,9-12,17-18H2,1-5H3/b13-8+ |
| InChIKey | MVPAZNJNLGEXQO-MDWZMJQESA-N |
| XLogP | 2.46 |
| TPSA | 103.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|