C20H25N3O6S — CID 85096180
2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]guanidine (PubChem CID 85096180) has the molecular formula C20H25N3O6S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]guanidine.
| Compound Name | 2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]guanidine |
|---|---|
| PubChem CID | 85096180 |
| Molecular Formula | C20H25N3O6S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.15 |
| IUPAC Name | 2-[2-methoxy-5-[2-(2,4,6-trimethoxyphenyl)ethenylsulfonylmethyl]phenyl]guanidine |
| SMILES | COc1cc(OC)c(C=CS(=O)(=O)Cc2ccc(OC)c(N=C(N)N)c2)c(OC)c1 |
| InChI | InChI=1S/C20H25N3O6S/c1-26-14-10-18(28-3)15(19(11-14)29-4)7-8-30(24,25)12-13-5-6-17(27-2)16(9-13)23-20(21)22/h5-11H,12H2,1-4H3,(H4,21,22,23) |
| InChIKey | HJVJXEHBEKUQPR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|